Products 2121512-87-4
CAS 2121512-87-4 appears in our catalog under these names: 3-Chloro-5-(hydroxymethyl)phenylboronic acid, 96%, (3-Chloro-5-(hydroxymethyl)phenyl)boronic acid, 97%, 97%, (3-Chloro-5-(hydroxymethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
[3-chloro-5-(hydroxymethyl)phenyl]boronic acid (CAS 2121512-87-4) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [3-chloro-5-(hydroxymethyl)phenyl]boronic acid. InChIKey: GAIOEGMKZDBACM-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [3-chloro-5-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | GAIOEGMKZDBACM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)CO)(O)O |
Computed by PubChem (NCBI)