CAS 1003042-59-8 appears in our catalog under these names: 2-Chloro-5-hydroxymethylphenylboronic acid, 98%, 2–Chloro–5–hydroxymethylphenylboronic acid, 2-Chloro-5-hydroxymethylphenylboronic acid 98%, 2-Chloro-5-hydroxymethylphenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
[2-chloro-5-(hydroxymethyl)phenyl]boronic acid (CAS 1003042-59-8) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [2-chloro-5-(hydroxymethyl)phenyl]boronic acid. InChIKey: OMQUJFBGPRFTIO-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [2-chloro-5-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | OMQUJFBGPRFTIO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CO)Cl)(O)O |
Computed by PubChem (NCBI)