Products 1451393-57-9
CAS 1451393-57-9 is the registry number for 3-Chloro-2-hydroxymethylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[3-chloro-2-(hydroxymethyl)phenyl]boronic acid (CAS 1451393-57-9) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [3-chloro-2-(hydroxymethyl)phenyl]boronic acid. InChIKey: VDDFRQZITTVMJA-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [3-chloro-2-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | VDDFRQZITTVMJA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)CO)(O)O |
Computed by PubChem (NCBI)