(2-Cyclopropyl-4-methoxyphenyl)boronic acid, 97%
cas: 2225173-99-7 — see every product listed under this CAS number, including other names
(2-Cyclopropyl-4-methoxyphenyl)boronic acid, 97% (CAS 2225173-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A616697-100mg |
| cas | 2225173-99-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1332.69 Pln | |
| Ambeed | 1g | 3385.25 Pln | |
| BLDpharm | 100mg | 803.08 Pln | |
| BLDpharm | 250mg | 1314.01 Pln | |
| BLDpharm | 1g | 3329.96 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1254.80 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| Fluorochem | 100mg | 1419.31 Pln | |
| Fluorochem | 250mg | 2325.24 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(2-cyclopropyl-4-methoxyphenyl)boronic acid (CAS 2225173-99-7) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2-cyclopropyl-4-methoxyphenyl)boronic acid. InChIKey: HQAQBORYDKRQHN-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2-cyclopropyl-4-methoxyphenyl)boronic acid |
| InChIKey | HQAQBORYDKRQHN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C2CC2)(O)O |
Computed by PubChem (NCBI)