Products 2225173-99-7
CAS 2225173-99-7 appears in our catalog under these names: (2–cyclopropyl–4–methoxyphenyl)boronic acid, (2-Cyclopropyl-4-methoxyphenyl)boronic acid 97%, (2-cyclopropyl-4-methoxyphenyl)boronic acid, 97%, 97%, (2-CYCLOPROPYL-4-METHOXYPHENYL)BORONIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 100mg, 250mg, 1g.
(2-cyclopropyl-4-methoxyphenyl)boronic acid (CAS 2225173-99-7) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2-cyclopropyl-4-methoxyphenyl)boronic acid. InChIKey: HQAQBORYDKRQHN-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2-cyclopropyl-4-methoxyphenyl)boronic acid |
| InChIKey | HQAQBORYDKRQHN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C2CC2)(O)O |
Computed by PubChem (NCBI)