cas: 677743-50-9 — see every product listed under this CAS number, including other names
(2-Chloro-4-cyanophenyl)boronic acid, 98% (CAS 677743-50-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215890-100MG |
| cas | 677743-50-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1788.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-chloro-4-cyanophenyl)boronic acid (CAS 677743-50-9) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (2-chloro-4-cyanophenyl)boronic acid. InChIKey: MSCQYLAIRMCGGF-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (2-chloro-4-cyanophenyl)boronic acid |
| InChIKey | MSCQYLAIRMCGGF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)Cl)(O)O |
Computed by PubChem (NCBI)