CAS 819070-53-6 appears in our catalog under these names: 4-Chloro-2-cyanophenylboronic acid, 98%, 4-Chloro-2-cyanophenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
(4-chloro-2-cyanophenyl)boronic acid (CAS 819070-53-6) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (4-chloro-2-cyanophenyl)boronic acid. InChIKey: SWBTXCSSSBWRQF-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (4-chloro-2-cyanophenyl)boronic acid |
| InChIKey | SWBTXCSSSBWRQF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)C#N)(O)O |
Computed by PubChem (NCBI)