Products 915763-60-9
CAS 915763-60-9 appears in our catalog under these names: (3–Chloro–5–cyanophenyl)boronic acid (contains varying amounts of Anhydride), 3-Chloro-5-cyanophenylboronic Acid (contains varying amounts of Anhydride), (3-Chloro-5-cyanophenyl)boronic acid 98%, (3-Chloro-5-cyanophenyl)boronic acid, 98%, 98%, (3-Chloro-5-cyanophenyl)boronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3-chloro-5-cyanophenyl)boronic acid (CAS 915763-60-9) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (3-chloro-5-cyanophenyl)boronic acid. InChIKey: DYVJQLYYHMZIIU-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (3-chloro-5-cyanophenyl)boronic acid |
| InChIKey | DYVJQLYYHMZIIU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C#N)(O)O |
Computed by PubChem (NCBI)