CAS 677743-50-9 appears in our catalog under these names: 2-Chloro-4-cyanophenylboronic acid, 98%, (2-Chloro-4-cyanophenyl)boronic Acid, 2–Chloro–4–cyanophenylboronic Acid, 2-Chloro-4-cyanophenylboronic Acid 98%, 2-Chloro-4-cyanophenylboronic Acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2-chloro-4-cyanophenyl)boronic acid (CAS 677743-50-9) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (2-chloro-4-cyanophenyl)boronic acid. InChIKey: MSCQYLAIRMCGGF-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (2-chloro-4-cyanophenyl)boronic acid |
| InChIKey | MSCQYLAIRMCGGF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)Cl)(O)O |
Computed by PubChem (NCBI)