Products 2759952-32-2
CAS 2759952-32-2 is the registry number for 7-Chloro-1H-benzo[d][1,2,6]oxazaborinin-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1-hydroxy-2,3,1-benzoxazaborinine (CAS 2759952-32-2) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: 7-chloro-1-hydroxy-2,3,1-benzoxazaborinine. InChIKey: ODBKUFKURLYSEB-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | 7-chloro-1-hydroxy-2,3,1-benzoxazaborinine |
| InChIKey | ODBKUFKURLYSEB-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)Cl)C=NO1)O |
Computed by PubChem (NCBI)