CAS 1072946-52-1 appears in our catalog under these names: 5-Chloro-2-cyanophenylboronic acid, 95%, (5–Chloro–2–cyanophenyl)boronic acid, (5-Chloro-2-cyanophenyl)boronic acid 98%, (5-Chloro-2-cyanophenyl)boronic acid, 95%, 95%, (5-Chloro-2-cyanophenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
(5-chloro-2-cyanophenyl)boronic acid (CAS 1072946-52-1) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (5-chloro-2-cyanophenyl)boronic acid. InChIKey: JXIINQQPEHZQAY-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (5-chloro-2-cyanophenyl)boronic acid |
| InChIKey | JXIINQQPEHZQAY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C#N)(O)O |
Computed by PubChem (NCBI)