Products 936249-33-1
CAS 936249-33-1 is the registry number for 2-Chloro-5-cyanophenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg.
(2-chloro-5-cyanophenyl)boronic acid (CAS 936249-33-1) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (2-chloro-5-cyanophenyl)boronic acid. InChIKey: YNZXUVCJPQNYHR-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (2-chloro-5-cyanophenyl)boronic acid |
| InChIKey | YNZXUVCJPQNYHR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C#N)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-5-cyanophenylboronic acid, (2-chloro-5-cyanophenyl)boronic acid, (2-chloro-5-cyano-phenyl)boronic Acid, 2-chloro-5-cyanobenzeneboronic acid, 2-Chloro-5-cyanophenylboronicacid, [2-Chloro-5-cyanophenyl]boronic acid, YNZXUVCJPQNYHR-UHFFFAOYSA-N, 2-chloro-5-cyanophenyl boronic acid, [6-Chloro-3-cyanophenyl]boronic acid, B-(2-Chloro-5-cyanophenyl)boronic acid