cas: 2121511-44-0 — see every product listed under this CAS number, including other names
(2-Chloro-5-fluoro-3-methylphenyl)boronic acid, 98% (CAS 2121511-44-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1195309-1g |
| cas | 2121511-44-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 655.90 Pln | |
| AmBeed | 100mg | 200.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-chloro-5-fluoro-3-methylphenyl)boronic acid (CAS 2121511-44-0) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (2-chloro-5-fluoro-3-methylphenyl)boronic acid. InChIKey: KHPUVWYDOOKESR-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (2-chloro-5-fluoro-3-methylphenyl)boronic acid |
| InChIKey | KHPUVWYDOOKESR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)C)F)(O)O |
Computed by PubChem (NCBI)