Products 2377608-77-8
CAS 2377608-77-8 appears in our catalog under these names: (3-Chloro-2-fluoro-4-methylphenyl)boronic acid, 98%, (3-Chloro-2-fluoro-4-methylphenyl)boronic acid, ≥95%, ≥95%, (3-Chloro-2-fluoro-4-methylphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g.
(3-chloro-2-fluoro-4-methylphenyl)boronic acid (CAS 2377608-77-8) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (3-chloro-2-fluoro-4-methylphenyl)boronic acid. InChIKey: ZSJCOQVNSALFEJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (3-chloro-2-fluoro-4-methylphenyl)boronic acid |
| InChIKey | ZSJCOQVNSALFEJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)Cl)F)(O)O |
Computed by PubChem (NCBI)