CAS 2055778-22-6 appears in our catalog under these names: 4-Chloro-5-fluoro-2-methylphenylboronic acid, 96%, (4-Chloro-5-fluoro-2-methylphenyl)boronic acid, 97%, 4-Chloro-5-fluoro-2-methylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(4-chloro-5-fluoro-2-methylphenyl)boronic acid (CAS 2055778-22-6) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-5-fluoro-2-methylphenyl)boronic acid. InChIKey: QEYSNUIQZFUGOZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-5-fluoro-2-methylphenyl)boronic acid |
| InChIKey | QEYSNUIQZFUGOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Cl)F)(O)O |
Computed by PubChem (NCBI)