Products 325786-09-2
CAS 325786-09-2 appears in our catalog under these names: (4-Chloro-2-fluoro-5-methylphenyl)boronic acid, (4-Chloro-2-fluoro-5-methylphenyl)boronic acid, 98%, (4-Chloro-2-fluoro-5-methylphenyl)boronic acid, 98%, 98%, (4-Chloro-2-fluoro-5-methylphenyl)boronic acid, ≥95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 10g, 25g, 1g, 100mg, 250mg.
(4-chloro-2-fluoro-5-methylphenyl)boronic acid (CAS 325786-09-2) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-2-fluoro-5-methylphenyl)boronic acid. InChIKey: JCYUEORYFOUSCZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-5-methylphenyl)boronic acid |
| InChIKey | JCYUEORYFOUSCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Cl)C)(O)O |
Computed by PubChem (NCBI)