Products 1612184-35-6

CAS 1612184-35-6 appears in our catalog under these names: 2-Chloro-5-fluoro-4-methylphenylboronic acid, 98%, 2-Chloro-5-fluoro-4-methylphenylboronic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

(2-chloro-5-fluoro-4-methylphenyl)boronic acid (CAS 1612184-35-6) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (2-chloro-5-fluoro-4-methylphenyl)boronic acid. InChIKey: XFHMSFKHEOXELL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BClFO2
Molecular weight188.39 g/mol
IUPAC name(2-chloro-5-fluoro-4-methylphenyl)boronic acid
InChIKeyXFHMSFKHEOXELL-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)C)F)(O)O

Computed by PubChem (NCBI)