CAS 1612184-35-6 appears in our catalog under these names: 2-Chloro-5-fluoro-4-methylphenylboronic acid, 98%, 2-Chloro-5-fluoro-4-methylphenylboronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
(2-chloro-5-fluoro-4-methylphenyl)boronic acid (CAS 1612184-35-6) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (2-chloro-5-fluoro-4-methylphenyl)boronic acid. InChIKey: XFHMSFKHEOXELL-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (2-chloro-5-fluoro-4-methylphenyl)boronic acid |
| InChIKey | XFHMSFKHEOXELL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C)F)(O)O |
Computed by PubChem (NCBI)