Products 1207428-93-0
CAS 1207428-93-0 appears in our catalog under these names: 2-Chloro-4-fluoro-5-methylphenylboronic acid, 98%, (2-Chloro-4-fluoro-5-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2-chloro-4-fluoro-5-methylphenyl)boronic acid (CAS 1207428-93-0) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (2-chloro-4-fluoro-5-methylphenyl)boronic acid. InChIKey: IZSSLSDISWWLLH-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (2-chloro-4-fluoro-5-methylphenyl)boronic acid |
| InChIKey | IZSSLSDISWWLLH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)F)C)(O)O |
Computed by PubChem (NCBI)