Products 944128-92-1
CAS 944128-92-1 appears in our catalog under these names: (4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 97%, (4-Chloro-2-fluoro-3-methylphenyl)boronic acid 98%, (4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 98%, 98%, (4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
(4-chloro-2-fluoro-3-methylphenyl)boronic acid (CAS 944128-92-1) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methylphenyl)boronic acid. InChIKey: GEQUDJQVXRZIIK-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methylphenyl)boronic acid |
| InChIKey | GEQUDJQVXRZIIK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)C)F)(O)O |
Computed by PubChem (NCBI)