cas: 77421-13-7 — see every product listed under this CAS number, including other names
(2-Chloro-phenyl)-methanesulfonyl chloride, 97% (CAS 77421-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020876-100MG |
| cas | 77421-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1539.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-chlorophenyl)methanesulfonyl chloride (CAS 77421-13-7) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: (2-chlorophenyl)methanesulfonyl chloride. InChIKey: CHPZYFXSICSCNY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | (2-chlorophenyl)methanesulfonyl chloride |
| InChIKey | CHPZYFXSICSCNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)