CAS 38452-47-0 appears in our catalog under these names: 1,2-Dichloro-4-methylsulfonylbenzene, 98%, 3,4-Dichlorophenylmethylsulfone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
1,2-dichloro-4-methylsulfonylbenzene (CAS 38452-47-0) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 1,2-dichloro-4-methylsulfonylbenzene. InChIKey: DNWUINQASFDJJS-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 1,2-dichloro-4-methylsulfonylbenzene |
| InChIKey | DNWUINQASFDJJS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)