Products 130562-97-9
CAS 130562-97-9 is the registry number for Ethyl 4,5-dichlorothiophene-2-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 4,5-dichlorothiophene-2-carboxylate (CAS 130562-97-9) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: ethyl 4,5-dichlorothiophene-2-carboxylate. InChIKey: KVTBSWABMQAIMZ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | ethyl 4,5-dichlorothiophene-2-carboxylate |
| InChIKey | KVTBSWABMQAIMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(S1)Cl)Cl |
Computed by PubChem (NCBI)