CAS 854626-27-0 is the registry number for Methyl 4,5-dichloro-3-methylthiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 4,5-dichloro-3-methylthiophene-2-carboxylate (CAS 854626-27-0) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: methyl 4,5-dichloro-3-methylthiophene-2-carboxylate. InChIKey: ONBHJNHOAHJNOU-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | methyl 4,5-dichloro-3-methylthiophene-2-carboxylate |
| InChIKey | ONBHJNHOAHJNOU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)