CAS 80563-86-6 appears in our catalog under these names: 3-Chloro-2-methylbenzenesulfonyl chloride, 98%, 3-Chloro-2-methylbenzene-1-sulfonyl chloride, 95% , 3-Chloro-2-methylbenzene-1-sulfonyl chloride 98%, 3-Chloro-2-methylbenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Thermo Scientific (Acros), Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
3-chloro-2-methylbenzenesulfonyl chloride (CAS 80563-86-6) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 3-chloro-2-methylbenzenesulfonyl chloride. InChIKey: ZSIYKAQPQRTBPF-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 3-chloro-2-methylbenzenesulfonyl chloride |
| InChIKey | ZSIYKAQPQRTBPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)