CAS 55311-94-9 appears in our catalog under these names: 2-Chloro-4-methylbenzenesulfonyl chloride, 95%, 2-Chloro-4-methylbenzenesulfonyl Chloride, 2-Chloro-4-methylbenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, TRC, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-chloro-4-methylbenzenesulfonyl chloride (CAS 55311-94-9) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 2-chloro-4-methylbenzenesulfonyl chloride. InChIKey: JWFLSLOCDIEDGQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2-chloro-4-methylbenzenesulfonyl chloride |
| InChIKey | JWFLSLOCDIEDGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)