Products 130562-95-7
CAS 130562-95-7 is the registry number for Ethyl 2,5-dichlorothiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2,5-dichlorothiophene-3-carboxylate (CAS 130562-95-7) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: ethyl 2,5-dichlorothiophene-3-carboxylate. InChIKey: NWRLHZNWNIDWFY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | ethyl 2,5-dichlorothiophene-3-carboxylate |
| InChIKey | NWRLHZNWNIDWFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)Cl)Cl |
Computed by PubChem (NCBI)