(2-Chlorophenyl)(3-chlorophenyl)methanone, 95+%
cas: 77008-58-3 — see every product listed under this CAS number, including other names
(2-Chlorophenyl)(3-chlorophenyl)methanone, 95+% (CAS 77008-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A461892-250mg |
| cas | 77008-58-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 737.50 Pln | |
| Ambeed | 10g | 1288.19 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1077.20 Pln | |
| Chemat | 10g | 1686.80 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 786.41 Pln | |
| BLDpharm | 10g | 1380.65 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
(2-chlorophenyl)-(3-chlorophenyl)methanone (CAS 77008-58-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2-chlorophenyl)-(3-chlorophenyl)methanone. InChIKey: ZOEYPNHFGDABED-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2-chlorophenyl)-(3-chlorophenyl)methanone |
| InChIKey | ZOEYPNHFGDABED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)