CAS 50609-23-9 is the registry number for (2,6-Dichlorophenyl)(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(2,6-dichlorophenyl)-phenylmethanone (CAS 50609-23-9) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,6-dichlorophenyl)-phenylmethanone. InChIKey: CVXUBCVZKVCBCU-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,6-dichlorophenyl)-phenylmethanone |
| InChIKey | CVXUBCVZKVCBCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)