CAS 85-29-0 appears in our catalog under these names: 2,4'-Dichlorobenzophenone, >95% (HPLC), 2,4'-Dichlorobenzophenone, 2,4'-Dichlorobenzophenone, >99.0%(GC), (2-Chlorophenyl)(4-chlorophenyl)methanone 98%, (2-Chlorophenyl)(4-chlorophenyl)methanone, 98%, 98%. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 2,5g, 25g, 250mg, 1kg, 0,5kg, 100g, 500g.
(2-chlorophenyl)-(4-chlorophenyl)methanone (CAS 85-29-0) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2-chlorophenyl)-(4-chlorophenyl)methanone. InChIKey: YXMYPHLWXBXNFF-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2-chlorophenyl)-(4-chlorophenyl)methanone |
| InChIKey | YXMYPHLWXBXNFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)