Products 1175949-53-7
CAS 1175949-53-7 is the registry number for 2,4-Dichloro-[1,1'-biphenyl]-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-3-phenylbenzaldehyde (CAS 1175949-53-7) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: 2,6-dichloro-3-phenylbenzaldehyde. InChIKey: NWLFRCUGHJYJRO-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 2,6-dichloro-3-phenylbenzaldehyde |
| InChIKey | NWLFRCUGHJYJRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C=C2)Cl)C=O)Cl |
Computed by PubChem (NCBI)