cas: 855230-63-6 — see every product listed under this CAS number, including other names
(2-Fluoro-3-isopropoxyphenyl)boronic acid 98% (CAS 855230-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A809194-100mg |
| cas | 855230-63-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A809194 |
(2-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 855230-63-6) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: CHXPLNUWFRHWDD-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | CHXPLNUWFRHWDD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)