Products 2096333-49-0
CAS 2096333-49-0 appears in our catalog under these names: 3-Ethoxy-2-fluoro-5-methylphenylboronic acid, 98%, (3-Ethoxy-2-fluoro-5-methylphenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g.
(3-ethoxy-2-fluoro-5-methylphenyl)boronic acid (CAS 2096333-49-0) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (3-ethoxy-2-fluoro-5-methylphenyl)boronic acid. InChIKey: UBTGSIOBPBXJMG-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (3-ethoxy-2-fluoro-5-methylphenyl)boronic acid |
| InChIKey | UBTGSIOBPBXJMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)OCC)C)(O)O |
Computed by PubChem (NCBI)