CAS 1704066-77-2 appears in our catalog under these names: (3-(Ethoxymethyl)-4-fluorophenyl)boronic acid, 95%, (3–(Ethoxymethyl)–4–fluorophenyl)boronic acid, B-[3-(Ethoxymethyl)-4-fluorophenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
[3-(ethoxymethyl)-4-fluorophenyl]boronic acid (CAS 1704066-77-2) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: [3-(ethoxymethyl)-4-fluorophenyl]boronic acid. InChIKey: JWFXXKJWAOJNIV-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | [3-(ethoxymethyl)-4-fluorophenyl]boronic acid |
| InChIKey | JWFXXKJWAOJNIV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)COCC)(O)O |
Computed by PubChem (NCBI)