Products 480438-73-1
CAS 480438-73-1 appears in our catalog under these names: 5-Fluoro-2-propoxyphenylboronic acid, 98%, (5-Fluoro-2-propoxyphenyl)boronic acid 98%, 5-Fluoro-2-propoxyphenylboronic acid, 98%, 98%, (5-Fluoro-2-propoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg.
(5-fluoro-2-propoxyphenyl)boronic acid (CAS 480438-73-1) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (5-fluoro-2-propoxyphenyl)boronic acid. InChIKey: TVQRNJJJJCUOLL-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (5-fluoro-2-propoxyphenyl)boronic acid |
| InChIKey | TVQRNJJJJCUOLL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCCC)(O)O |
Computed by PubChem (NCBI)