CAS 871126-09-9 is the registry number for 2-Fluoro-3-propoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 100g.
(2-fluoro-3-propoxyphenyl)boronic acid (CAS 871126-09-9) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-3-propoxyphenyl)boronic acid. InChIKey: DZDCTNMDWXZTDO-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-3-propoxyphenyl)boronic acid |
| InChIKey | DZDCTNMDWXZTDO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCCC)F)(O)O |
Computed by PubChem (NCBI)