Products 1451391-66-4

CAS 1451391-66-4 is the registry number for 6-Ethoxy-2-fluoro-3-methylphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(6-ethoxy-2-fluoro-3-methylphenyl)boronic acid (CAS 1451391-66-4) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (6-ethoxy-2-fluoro-3-methylphenyl)boronic acid. InChIKey: JTSLXSWVFHCAPO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BFO3
Molecular weight198.00 g/mol
IUPAC name(6-ethoxy-2-fluoro-3-methylphenyl)boronic acid
InChIKeyJTSLXSWVFHCAPO-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)C)OCC)(O)O

Computed by PubChem (NCBI)