Products 2096337-59-4
CAS 2096337-59-4 appears in our catalog under these names: 2-Ethoxy-4-fluoro-5-methylphenylboronic acid, 2-Ethoxy-4-fluoro-5-methylphenylboronic acid, 97%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(2-ethoxy-4-fluoro-5-methylphenyl)boronic acid (CAS 2096337-59-4) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-ethoxy-4-fluoro-5-methylphenyl)boronic acid. InChIKey: LAVUZOVMQMSZSP-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-ethoxy-4-fluoro-5-methylphenyl)boronic acid |
| InChIKey | LAVUZOVMQMSZSP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)F)C)(O)O |
Computed by PubChem (NCBI)