cas: 871126-09-9 — see every product listed under this CAS number, including other names
(2-Fluoro-3-propoxyphenyl)boronic acid (CAS 871126-09-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216204-5G |
| cas | 871126-09-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1591.12 Pln | |
| Fluorochem | 10g | 2658.46 Pln |
| delivery time | 3-4 weeks |
|---|
(2-fluoro-3-propoxyphenyl)boronic acid (CAS 871126-09-9) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-3-propoxyphenyl)boronic acid. InChIKey: DZDCTNMDWXZTDO-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-3-propoxyphenyl)boronic acid |
| InChIKey | DZDCTNMDWXZTDO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCCC)F)(O)O |
Computed by PubChem (NCBI)