cas: 849062-30-2 — see every product listed under this CAS number, including other names
(2-Fluoro-5-isopropoxyphenyl)boronic acid 97% (CAS 849062-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407109-250mg |
| cas | 849062-30-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 25g | 1432.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A407109 |
(2-fluoro-5-propan-2-yloxyphenyl)boronic acid (CAS 849062-30-2) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-5-propan-2-yloxyphenyl)boronic acid. InChIKey: IEBGLDYEUYTUMZ-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | IEBGLDYEUYTUMZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)