(2-Fluoro-6-propoxyphenyl)boronic acid, 97%
cas: 870777-18-7 — see every product listed under this CAS number, including other names
(2-Fluoro-6-propoxyphenyl)boronic acid, 97% (CAS 870777-18-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A569348-25g |
| cas | 870777-18-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 4132.24 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1664.02 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1149.20 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 925.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-fluoro-6-propoxyphenyl)boronic acid (CAS 870777-18-7) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-6-propoxyphenyl)boronic acid. InChIKey: MRVRMZWHFZYTCY-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-6-propoxyphenyl)boronic acid |
| InChIKey | MRVRMZWHFZYTCY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1F)OCCC)(O)O |
Computed by PubChem (NCBI)