(2-Hydroxy-4-(trifluoromethyl)phenyl)boronic acid, 98%
cas: 1072951-50-8 — see every product listed under this CAS number, including other names
(2-Hydroxy-4-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 1072951-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217251-100MG |
| cas | 1072951-50-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 924.69 Pln | |
| Fluorochem | 100g | 2507.47 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1072951-50-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: GYGNUMOLFBSVCL-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GYGNUMOLFBSVCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)