Products 1187874-94-7
CAS 1187874-94-7 appears in our catalog under these names: (4–Hydroxy–3–(trifluoromethyl)phenyl)boronic acid, (4-Hydroxy-3-(trifluoromethyl)phenyl)boronic acid 97%, (4-Hydroxy-3-(trifluoromethyl)phenyl)boronic acid, 97%, 97%, (4-Hydroxy-3-(trifluoromethyl)phenyl)boronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
[4-hydroxy-3-(trifluoromethyl)phenyl]boronic acid (CAS 1187874-94-7) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [4-hydroxy-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: GAQZFSBHSWBMRW-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [4-hydroxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GAQZFSBHSWBMRW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)