CAS 2055539-69-8 appears in our catalog under these names: (3-(Difluoromethoxy)-5-fluorophenyl)boronic acid 98%, (3-(Difluoromethoxy)-5-fluorophenyl)boronic acid, ≥95%, ≥95%, (3-(Difluoromethoxy)-5-fluorophenyl)boronic acid, ≥95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[3-(difluoromethoxy)-5-fluorophenyl]boronic acid (CAS 2055539-69-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [3-(difluoromethoxy)-5-fluorophenyl]boronic acid. InChIKey: WLVLRKGGNZFFBQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [3-(difluoromethoxy)-5-fluorophenyl]boronic acid |
| InChIKey | WLVLRKGGNZFFBQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OC(F)F)(O)O |
Computed by PubChem (NCBI)