cas: 2096333-79-6 — see every product listed under this CAS number, including other names
(2-Hydroxy-6-(trifluoromethyl)phenyl)boronic acid, 95% (CAS 2096333-79-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A280370-100mg |
| cas | 2096333-79-6 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1391.53 Pln | |
| AmBeed | 5g | 15726.55 Pln | |
| AmBeed | 10g | 26813.08 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-hydroxy-6-(trifluoromethyl)phenyl]boronic acid (CAS 2096333-79-6) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [2-hydroxy-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: FNBWZLJDEFUGAL-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [2-hydroxy-6-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FNBWZLJDEFUGAL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)