cas: 2246683-46-3 — see every product listed under this CAS number, including other names
(2-chloro-4,5-dimethylphenyl)boronic acid, ≥95%, ≥95% (CAS 2246683-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13A7M7-1g |
| cas | 2246683-46-3 |
| size | 1g |
| availability | 41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3530.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-4,5-dimethylphenyl)boronic acid (CAS 2246683-46-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (2-chloro-4,5-dimethylphenyl)boronic acid. InChIKey: IZISMMRQFIVXCU-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (2-chloro-4,5-dimethylphenyl)boronic acid |
| InChIKey | IZISMMRQFIVXCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C)C)(O)O |
Computed by PubChem (NCBI)