Products 918810-94-3
CAS 918810-94-3 appears in our catalog under these names: (4-Chloro-3-ethylphenyl)boronic acid, 98%, (4-Chloro-3-ethylphenyl)boronic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-chloro-3-ethylphenyl)boronic acid (CAS 918810-94-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-3-ethylphenyl)boronic acid. InChIKey: ZFQZOBHIZWUBEZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-3-ethylphenyl)boronic acid |
| InChIKey | ZFQZOBHIZWUBEZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CC)(O)O |
Computed by PubChem (NCBI)