CAS 93847-77-9 appears in our catalog under these names: (2R,3R)/(2S,3S)-Racemic boc-beta-hydroxy-phenylalanine, 95%, Boc-erythro-beta-phenylserine, Boc-beta-hydroxy-Phe-OH (RR,SS). Offered by: Combi-blocks, TRC, Iris Biotech. Available pack sizes: 100mg, 250mg, 1g.
(2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 93847-77-9) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: NONUVMOXNPGTBK-GHMZBOCLSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | NONUVMOXNPGTBK-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]([C@@H](C1=CC=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)