cas: 622-00-4 — see every product listed under this CAS number, including other names
(2R,3R)-Dibenzyl 2,3-dihydroxysuccinate, 96% (CAS 622-00-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986582-5G |
| cas | 622-00-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 633.13 Pln | |
| Fluorochem | 25g | 919.49 Pln | |
| Fluorochem | 50g | 1596.33 Pln | |
| Fluorochem | 100g | 2955.23 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Dibenzyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 622-00-4) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: dibenzyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: LCKIPSGLXMCAOF-HZPDHXFCSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | dibenzyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | LCKIPSGLXMCAOF-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H]([C@H](C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)