Products 861446-14-2
CAS 861446-14-2 appears in our catalog under these names: Resveratrol Impurity 25 (Resveratrol 3,4’-Diacetate）, Resveratrol 3,4’-Diacetate, >95% (HPLC), Resveratrol 3,4’-diacetate. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Acetic acid;[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] acetate (CAS 861446-14-2) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: acetic acid;[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] acetate. InChIKey: PEZYIJKTHUIHSD-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | acetic acid;[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] acetate |
| InChIKey | PEZYIJKTHUIHSD-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)OC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)O)O |
Computed by PubChem (NCBI)