cas: 100157-53-7 — see every product listed under this CAS number, including other names
(2R,3R)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-hydroxybutanoate, >95%, >95% (CAS 100157-53-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111255-100mg |
| cas | 100157-53-7 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1082.00 Pln | |
| Chemat | 10g | 2046.80 Pln | |
| Chemat | 25g | 4034.00 Pln | |
| Chemat | 100g | 9986.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 100157-53-7) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-MWLCHTKSSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-MWLCHTKSSA-N |
| SMILES | C[C@H]([C@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)